C16H20ClN3O3 — CID 72837719
2-(3-chloro-4-methoxyphenyl)-2-[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]acetic acid (PubChem CID 72837719) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-2-[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]acetic acid.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-2-[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 72837719 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-2-[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]acetic acid |
| SMILES | COc1ccc(C(C(=O)O)N(C)CCn2ccnc2C)cc1Cl |
| InChI | InChI=1S/C16H20ClN3O3/c1-11-18-6-7-20(11)9-8-19(2)15(16(21)22)12-4-5-14(23-3)13(17)10-12/h4-7,10,15H,8-9H2,1-3H3,(H,21,22) |
| InChIKey | TUFKQPYQZXDLIG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |