C16H19ClFN3O2 — CID 95625436
(2S)-2-(2-chloro-4-fluorophenoxy)-N-[3-(2-methylimidazol-1-yl)propyl]propanamide (PubChem CID 95625436) has the molecular formula C16H19ClFN3O2 and a molecular weight of 339.80 g/mol. Its IUPAC name is (2S)-2-(2-chloro-4-fluorophenoxy)-N-[3-(2-methylimidazol-1-yl)propyl]propanamide.
| Compound Name | (2S)-2-(2-chloro-4-fluorophenoxy)-N-[3-(2-methylimidazol-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 95625436 |
| Molecular Formula | C16H19ClFN3O2 |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (2S)-2-(2-chloro-4-fluorophenoxy)-N-[3-(2-methylimidazol-1-yl)propyl]propanamide |
| SMILES | Cc1nccn1CCCNC(=O)[C@H](C)Oc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H19ClFN3O2/c1-11(23-15-5-4-13(18)10-14(15)17)16(22)20-6-3-8-21-9-7-19-12(21)2/h4-5,7,9-11H,3,6,8H2,1-2H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | ACAOBHODAMCAIV-NSHDSACASA-N |
| XLogP | 2.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|