C17H19ClFN3O2 — CID 124753177
(2S)-2-(2-chloro-4-fluorophenoxy)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide (PubChem CID 124753177) has the molecular formula C17H19ClFN3O2 and a molecular weight of 351.81 g/mol. Its IUPAC name is (2S)-2-(2-chloro-4-fluorophenoxy)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide.
| Compound Name | (2S)-2-(2-chloro-4-fluorophenoxy)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 124753177 |
| Molecular Formula | C17H19ClFN3O2 |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (2S)-2-(2-chloro-4-fluorophenoxy)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide |
| SMILES | Cc1cnccc1NCCNC(=O)[C@H](C)Oc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H19ClFN3O2/c1-11-10-20-6-5-15(11)21-7-8-22-17(23)12(2)24-16-4-3-13(19)9-14(16)18/h3-6,9-10,12H,7-8H2,1-2H3,(H,20,21)(H,22,23)/t12-/m0/s1 |
| InChIKey | LKUJWXHJBQGYSQ-LBPRGKRZSA-N |
| XLogP | 3.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|