C15H17ClFN3 — CID 68761252
N-[(2-chloro-4-fluorophenyl)methyl]-N'-(3-methyl-4-pyridinyl)ethane-1,2-diamine (PubChem CID 68761252) has the molecular formula C15H17ClFN3 and a molecular weight of 293.77 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-N'-(3-methyl-4-pyridinyl)ethane-1,2-diamine.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-N'-(3-methyl-4-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 68761252 |
| Molecular Formula | C15H17ClFN3 |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-N'-(3-methyl-4-pyridinyl)ethane-1,2-diamine |
| SMILES | Cc1cnccc1NCCNCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H17ClFN3/c1-11-9-18-5-4-15(11)20-7-6-19-10-12-2-3-13(17)8-14(12)16/h2-5,8-9,19H,6-7,10H2,1H3,(H,18,20) |
| InChIKey | DZTJKWATMQWCPP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|