C26H35ClF3NO4Si — CID 171849148
1-[3-chloro-4-(trifluoromethoxy)-N-[3-tri(propan-2-yl)silylprop-2-ynoyl]anilino]cyclohexane-1-carboxylic acid (PubChem CID 171849148) has the molecular formula C26H35ClF3NO4Si and a molecular weight of 546.10 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethoxy)-N-[3-tri(propan-2-yl)silylprop-2-ynoyl]anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-chloro-4-(trifluoromethoxy)-N-[3-tri(propan-2-yl)silylprop-2-ynoyl]anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171849148 |
| Molecular Formula | C26H35ClF3NO4Si |
| Molecular Weight | 546.10 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethoxy)-N-[3-tri(propan-2-yl)silylprop-2-ynoyl]anilino]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)[Si](C#CC(=O)N(c1ccc(OC(F)(F)F)c(Cl)c1)C1(C(=O)O)CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H35ClF3NO4Si/c1-17(2)36(18(3)4,19(5)6)15-12-23(32)31(25(24(33)34)13-8-7-9-14-25)20-10-11-22(21(27)16-20)35-26(28,29)30/h10-11,16-19H,7-9,13-14H2,1-6H3,(H,33,34) |
| InChIKey | YNHYJINIBDGEAN-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.10 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|