C17H12Cl2F5NO4 — CID 171848797
1-[3,5-dichloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]-4,4-difluorocyclohexane-1-carboxylic acid (PubChem CID 171848797) has the molecular formula C17H12Cl2F5NO4 and a molecular weight of 460.18 g/mol. Its IUPAC name is 1-[3,5-dichloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]-4,4-difluorocyclohexane-1-carboxylic acid.
| Compound Name | 1-[3,5-dichloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]-4,4-difluorocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171848797 |
| Molecular Formula | C17H12Cl2F5NO4 |
| Molecular Weight | 460.18 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | 1-[3,5-dichloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]-4,4-difluorocyclohexane-1-carboxylic acid |
| SMILES | C#CC(=O)N(c1cc(Cl)c(OC(F)(F)F)c(Cl)c1)C1(C(=O)O)CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H12Cl2F5NO4/c1-2-12(26)25(15(14(27)28)3-5-16(20,21)6-4-15)9-7-10(18)13(11(19)8-9)29-17(22,23)24/h1,7-8H,3-6H2,(H,27,28) |
| InChIKey | OMXANNWUCGYRKA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.18 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|