C19H23ClNO4+ — CID 171849146
[1-[3-chloro-4-[(2-methylpropan-2-yl)oxy]-N-prop-2-ynoylanilino]cyclopentanecarbonyl]oxidanium (PubChem CID 171849146) has the molecular formula C19H23ClNO4+ and a molecular weight of 364.85 g/mol. Its IUPAC name is [1-[3-chloro-4-[(2-methylpropan-2-yl)oxy]-N-prop-2-ynoylanilino]cyclopentanecarbonyl]oxidanium.
| Compound Name | [1-[3-chloro-4-[(2-methylpropan-2-yl)oxy]-N-prop-2-ynoylanilino]cyclopentanecarbonyl]oxidanium |
|---|---|
| PubChem CID | 171849146 |
| Molecular Formula | C19H23ClNO4+ |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [1-[3-chloro-4-[(2-methylpropan-2-yl)oxy]-N-prop-2-ynoylanilino]cyclopentanecarbonyl]oxidanium |
| SMILES | C#CC(=O)N(c1ccc(OC(C)(C)C)c(Cl)c1)C1(C(=O)[OH2+])CCCC1 |
| InChI | InChI=1S/C19H22ClNO4/c1-5-16(22)21(19(17(23)24)10-6-7-11-19)13-8-9-15(14(20)12-13)25-18(2,3)4/h1,8-9,12H,6-7,10-11H2,2-4H3,(H,23,24)/p+1 |
| InChIKey | CLRFWAHUTDXGRW-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 69.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|