C19H22ClN3O4S — CID 170769313
1-[3-chloro-4-(cyclopropylsulfonylamino)-N-prop-2-ynoylanilino]cyclohexane-1-carboxamide (PubChem CID 170769313) has the molecular formula C19H22ClN3O4S and a molecular weight of 423.92 g/mol. Its IUPAC name is 1-[3-chloro-4-(cyclopropylsulfonylamino)-N-prop-2-ynoylanilino]cyclohexane-1-carboxamide.
| Compound Name | 1-[3-chloro-4-(cyclopropylsulfonylamino)-N-prop-2-ynoylanilino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 170769313 |
| Molecular Formula | C19H22ClN3O4S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 1-[3-chloro-4-(cyclopropylsulfonylamino)-N-prop-2-ynoylanilino]cyclohexane-1-carboxamide |
| SMILES | C#CC(=O)N(c1ccc(NS(=O)(=O)C2CC2)c(Cl)c1)C1(C(N)=O)CCCCC1 |
| InChI | InChI=1S/C19H22ClN3O4S/c1-2-17(24)23(19(18(21)25)10-4-3-5-11-19)13-6-9-16(15(20)12-13)22-28(26,27)14-7-8-14/h1,6,9,12,14,22H,3-5,7-8,10-11H2,(H2,21,25) |
| InChIKey | VEMKFHRCPBDRAQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|