C16H13ClF3NO5 — CID 171848696
3-[3-chloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]oxane-3-carboxylic acid (PubChem CID 171848696) has the molecular formula C16H13ClF3NO5 and a molecular weight of 391.73 g/mol. Its IUPAC name is 3-[3-chloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]oxane-3-carboxylic acid.
| Compound Name | 3-[3-chloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 171848696 |
| Molecular Formula | C16H13ClF3NO5 |
| Molecular Weight | 391.73 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 3-[3-chloro-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]oxane-3-carboxylic acid |
| SMILES | C#CC(=O)N(c1ccc(OC(F)(F)F)c(Cl)c1)C1(C(=O)O)CCCOC1 |
| InChI | InChI=1S/C16H13ClF3NO5/c1-2-13(22)21(15(14(23)24)6-3-7-25-9-15)10-4-5-12(11(17)8-10)26-16(18,19)20/h1,4-5,8H,3,6-7,9H2,(H,23,24) |
| InChIKey | KUNPTDCCQXKFKA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|