C17H15ClF3NO5 — CID 171848811
4-[5-chloro-2-methyl-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]oxane-4-carboxylic acid (PubChem CID 171848811) has the molecular formula C17H15ClF3NO5 and a molecular weight of 405.76 g/mol. Its IUPAC name is 4-[5-chloro-2-methyl-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]oxane-4-carboxylic acid.
| Compound Name | 4-[5-chloro-2-methyl-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 171848811 |
| Molecular Formula | C17H15ClF3NO5 |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-[5-chloro-2-methyl-N-prop-2-ynoyl-4-(trifluoromethoxy)anilino]oxane-4-carboxylic acid |
| SMILES | C#CC(=O)N(c1cc(Cl)c(OC(F)(F)F)cc1C)C1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C17H15ClF3NO5/c1-3-14(23)22(16(15(24)25)4-6-26-7-5-16)12-9-11(18)13(8-10(12)2)27-17(19,20)21/h1,8-9H,4-7H2,2H3,(H,24,25) |
| InChIKey | MLZIXOYJPVLREX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|