C22H25ClF3NO4 — CID 171848766
1-[3-chloro-N-prop-2-ynoyl-4-(2,2,2-trifluoroethoxy)anilino]-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid (PubChem CID 171848766) has the molecular formula C22H25ClF3NO4 and a molecular weight of 459.89 g/mol. Its IUPAC name is 1-[3-chloro-N-prop-2-ynoyl-4-(2,2,2-trifluoroethoxy)anilino]-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-chloro-N-prop-2-ynoyl-4-(2,2,2-trifluoroethoxy)anilino]-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171848766 |
| Molecular Formula | C22H25ClF3NO4 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-[3-chloro-N-prop-2-ynoyl-4-(2,2,2-trifluoroethoxy)anilino]-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid |
| SMILES | C#CC(=O)N(c1ccc(OCC(F)(F)F)c(Cl)c1)C1(C(=O)O)CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C22H25ClF3NO4/c1-6-17(28)27(14-7-8-16(15(23)9-14)31-13-22(24,25)26)21(18(29)30)11-19(2,3)10-20(4,5)12-21/h1,7-9H,10-13H2,2-5H3,(H,29,30) |
| InChIKey | WIEUFSQQLCVUKH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|