C17H19FN2O3 — CID 170769113
4-[3-(fluoromethyl)-4-methyl-N-prop-2-ynoylanilino]oxane-4-carboxamide (PubChem CID 170769113) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is 4-[3-(fluoromethyl)-4-methyl-N-prop-2-ynoylanilino]oxane-4-carboxamide.
| Compound Name | 4-[3-(fluoromethyl)-4-methyl-N-prop-2-ynoylanilino]oxane-4-carboxamide |
|---|---|
| PubChem CID | 170769113 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-[3-(fluoromethyl)-4-methyl-N-prop-2-ynoylanilino]oxane-4-carboxamide |
| SMILES | C#CC(=O)N(c1ccc(C)c(CF)c1)C1(C(N)=O)CCOCC1 |
| InChI | InChI=1S/C17H19FN2O3/c1-3-15(21)20(14-5-4-12(2)13(10-14)11-18)17(16(19)22)6-8-23-9-7-17/h1,4-5,10H,6-9,11H2,2H3,(H2,19,22) |
| InChIKey | KFADLNWMXFMVJS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|