C9H11F — CID 15724447
2-(fluoromethyl)-1,4-dimethylbenzene (PubChem CID 15724447) has the molecular formula C9H11F and a molecular weight of 138.18 g/mol. Its IUPAC name is 2-(fluoromethyl)-1,4-dimethylbenzene.
| Compound Name | 2-(fluoromethyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 15724447 |
| Molecular Formula | C9H11F |
| Molecular Weight | 138.18 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2-(fluoromethyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(CF)c1 |
| InChI | InChI=1S/C9H11F/c1-7-3-4-8(2)9(5-7)6-10/h3-5H,6H2,1-2H3 |
| InChIKey | GAROTQAQUBYTJU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |