C10H14S — CID 11768926
1,4-dimethyl-2-(methylsulfanylmethyl)benzene (PubChem CID 11768926) has the molecular formula C10H14S and a molecular weight of 166.29 g/mol. Its IUPAC name is 1,4-dimethyl-2-(methylsulfanylmethyl)benzene.
| Compound Name | 1,4-dimethyl-2-(methylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 11768926 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1,4-dimethyl-2-(methylsulfanylmethyl)benzene |
| SMILES | CSCc1cc(C)ccc1C |
| InChI | InChI=1S/C10H14S/c1-8-4-5-9(2)10(6-8)7-11-3/h4-6H,7H2,1-3H3 |
| InChIKey | RQHYVZVWQZOEBB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |