C13H18S — CID 146249408
1,4-dimethyl-2-[2-(methylsulfanylmethyl)prop-2-enyl]benzene (PubChem CID 146249408) has the molecular formula C13H18S and a molecular weight of 206.35 g/mol. Its IUPAC name is 1,4-dimethyl-2-[2-(methylsulfanylmethyl)prop-2-enyl]benzene.
| Compound Name | 1,4-dimethyl-2-[2-(methylsulfanylmethyl)prop-2-enyl]benzene |
|---|---|
| PubChem CID | 146249408 |
| Molecular Formula | C13H18S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1,4-dimethyl-2-[2-(methylsulfanylmethyl)prop-2-enyl]benzene |
| SMILES | C=C(CSC)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C13H18S/c1-10-5-6-12(3)13(7-10)8-11(2)9-14-4/h5-7H,2,8-9H2,1,3-4H3 |
| InChIKey | AXXCTAGLBSBQSN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|