C13H16O2 — CID 82076929
1-(2,5-dimethylphenyl)pentane-2,4-dione (PubChem CID 82076929) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)pentane-2,4-dione.
| Compound Name | 1-(2,5-dimethylphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 82076929 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)pentane-2,4-dione |
| SMILES | CC(=O)CC(=O)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C13H16O2/c1-9-4-5-10(2)12(6-9)8-13(15)7-11(3)14/h4-6H,7-8H2,1-3H3 |
| InChIKey | VGQNKIWSJLMTKC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|