C17H16BrFO — CID 114968486
1-(4-bromo-2-fluorophenyl)-3-(2,5-dimethylphenyl)propan-2-one (PubChem CID 114968486) has the molecular formula C17H16BrFO and a molecular weight of 335.22 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(2,5-dimethylphenyl)propan-2-one.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(2,5-dimethylphenyl)propan-2-one |
|---|---|
| PubChem CID | 114968486 |
| Molecular Formula | C17H16BrFO |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(2,5-dimethylphenyl)propan-2-one |
| SMILES | Cc1ccc(C)c(CC(=O)Cc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C17H16BrFO/c1-11-3-4-12(2)14(7-11)9-16(20)8-13-5-6-15(18)10-17(13)19/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | WRJSFMYEFHIDQT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |