C12H19NS — CID 66219052
3-[(2,5-dimethylphenyl)methylsulfanyl]propan-1-amine (PubChem CID 66219052) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)methylsulfanyl]propan-1-amine.
| Compound Name | 3-[(2,5-dimethylphenyl)methylsulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 66219052 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)methylsulfanyl]propan-1-amine |
| SMILES | Cc1ccc(C)c(CSCCCN)c1 |
| InChI | InChI=1S/C12H19NS/c1-10-4-5-11(2)12(8-10)9-14-7-3-6-13/h4-5,8H,3,6-7,9,13H2,1-2H3 |
| InChIKey | YHILUQUVRHKRCM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|