About CID 68591460
CID 68591460 (PubChem CID 68591460) has the molecular formula C10H13F2Si
and a molecular weight of 199.30 g/mol.
Molecular Properties
| Compound Name | CID 68591460 |
| PubChem CID | 68591460 |
| Molecular Formula | C10H13F2Si |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C)c(CCF)c1.F[Si] |
| InChI | InChI=1S/C10H13F.FSi/c1-8-3-4-9(2)10(7-8)5-6-11;1-2/h3-4,7H,5-6H2,1-2H3; |
| InChIKey | LBZDGEBEFUESDK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 68591460 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68591460?
The IUPAC name of CID 68591460 (CID 68591460) is not available.
What is the SMILES notation for CID 68591460?
The canonical SMILES for CID 68591460 is Cc1ccc(C)c(CCF)c1.F[Si].
What is the InChIKey of CID 68591460?
The InChIKey is LBZDGEBEFUESDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F.FSi/c1-8-3-4-9(2)10(7-8)5-6-11;1-2/h3-4,7H,5-6H2,1-2H3;.
What are the key properties of CID 68591460?
CID 68591460 has a molecular weight of 199.30 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68591460 is sourced from PubChem (CID 68591460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).