C35H49FN2O5Si — CID 175998047
N-[(2,4-dimethoxyphenyl)methyl]-4-[3-(fluoromethyl)-4-methyl-N-[3-tri(propan-2-yl)silylprop-2-ynoyl]anilino]oxane-4-carboxamide (PubChem CID 175998047) has the molecular formula C35H49FN2O5Si and a molecular weight of 624.87 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-[3-(fluoromethyl)-4-methyl-N-[3-tri(propan-2-yl)silylprop-2-ynoyl]anilino]oxane-4-carboxamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[3-(fluoromethyl)-4-methyl-N-[3-tri(propan-2-yl)silylprop-2-ynoyl]anilino]oxane-4-carboxamide |
|---|---|
| PubChem CID | 175998047 |
| Molecular Formula | C35H49FN2O5Si |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[3-(fluoromethyl)-4-methyl-N-[3-tri(propan-2-yl)silylprop-2-ynoyl]anilino]oxane-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)C2(N(C(=O)C#C[Si](C(C)C)(C(C)C)C(C)C)c3ccc(C)c(CF)c3)CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C35H49FN2O5Si/c1-24(2)44(25(3)4,26(5)6)19-14-33(39)38(30-12-10-27(7)29(20-30)22-36)35(15-17-43-18-16-35)34(40)37-23-28-11-13-31(41-8)21-32(28)42-9/h10-13,20-21,24-26H,15-18,22-23H2,1-9H3,(H,37,40) |
| InChIKey | ITMYUQXJBRNEHM-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|