C18H30IN3O3S — CID 111689985
1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111689985) has the molecular formula C18H30IN3O3S and a molecular weight of 495.43 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111689985 |
| Molecular Formula | C18H30IN3O3S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)cc1OC)NCC1(SC)CCOCC1.I |
| InChI | InChI=1S/C18H29N3O3S.HI/c1-19-17(21-13-18(25-4)7-9-24-10-8-18)20-12-14-5-6-15(22-2)11-16(14)23-3;/h5-6,11H,7-10,12-13H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | APAZKNMDRREHRU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|