C22H36N4O3S — CID 111515106
1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine (PubChem CID 111515106) has the molecular formula C22H36N4O3S and a molecular weight of 436.62 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111515106 |
| Molecular Formula | C22H36N4O3S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC(c1ccc(OC)cc1)N1CCOCC1)NCC1(SC)CCOCC1 |
| InChI | InChI=1S/C22H36N4O3S/c1-23-21(25-17-22(30-3)8-12-28-13-9-22)24-16-20(26-10-14-29-15-11-26)18-4-6-19(27-2)7-5-18/h4-7,20H,8-17H2,1-3H3,(H2,23,24,25) |
| InChIKey | YFHILMLGNNNEDT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|