C14H15ClF3NO3 — CID 171849054
1-[3-chloro-4-(trifluoromethoxy)anilino]cyclohexane-1-carboxylic acid (PubChem CID 171849054) has the molecular formula C14H15ClF3NO3 and a molecular weight of 337.73 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethoxy)anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-chloro-4-(trifluoromethoxy)anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171849054 |
| Molecular Formula | C14H15ClF3NO3 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethoxy)anilino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(Nc2ccc(OC(F)(F)F)c(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C14H15ClF3NO3/c15-10-8-9(4-5-11(10)22-14(16,17)18)19-13(12(20)21)6-2-1-3-7-13/h4-5,8,19H,1-3,6-7H2,(H,20,21) |
| InChIKey | JCACUNHDDGRZFY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|