C13H14ClF3N2O3 — CID 171848904
4-[3-chloro-4-(trifluoromethoxy)anilino]oxane-4-carboxamide (PubChem CID 171848904) has the molecular formula C13H14ClF3N2O3 and a molecular weight of 338.71 g/mol. Its IUPAC name is 4-[3-chloro-4-(trifluoromethoxy)anilino]oxane-4-carboxamide.
| Compound Name | 4-[3-chloro-4-(trifluoromethoxy)anilino]oxane-4-carboxamide |
|---|---|
| PubChem CID | 171848904 |
| Molecular Formula | C13H14ClF3N2O3 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-[3-chloro-4-(trifluoromethoxy)anilino]oxane-4-carboxamide |
| SMILES | NC(=O)C1(Nc2ccc(OC(F)(F)F)c(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C13H14ClF3N2O3/c14-9-7-8(1-2-10(9)22-13(15,16)17)19-12(11(18)20)3-5-21-6-4-12/h1-2,7,19H,3-6H2,(H2,18,20) |
| InChIKey | UXAAXNJGJRWYNE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|