C27H39N3O2Si — CID 152586892
2-[[4-[(1,4-dimethylpiperidin-4-yl)methoxy]-3-phenylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 152586892) has the molecular formula C27H39N3O2Si and a molecular weight of 465.71 g/mol. Its IUPAC name is 2-[[4-[(1,4-dimethylpiperidin-4-yl)methoxy]-3-phenylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[(1,4-dimethylpiperidin-4-yl)methoxy]-3-phenylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 152586892 |
| Molecular Formula | C27H39N3O2Si |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 2-[[4-[(1,4-dimethylpiperidin-4-yl)methoxy]-3-phenylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CN1CCC(C)(COc2ccnc3c2c(-c2ccccc2)cn3COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C27H39N3O2Si/c1-27(12-15-29(2)16-13-27)20-32-24-11-14-28-26-25(24)23(22-9-7-6-8-10-22)19-30(26)21-31-17-18-33(3,4)5/h6-11,14,19H,12-13,15-18,20-21H2,1-5H3 |
| InChIKey | YUQOMXUAOPEVNM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|