C25H30BrClN4O4Si — CID 156845932
tert-butyl N-[4-[3-bromo-5-cyano-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-chlorophenyl]carbamate (PubChem CID 156845932) has the molecular formula C25H30BrClN4O4Si and a molecular weight of 593.98 g/mol. Its IUPAC name is tert-butyl N-[4-[3-bromo-5-cyano-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-chlorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-bromo-5-cyano-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-chlorophenyl]carbamate |
|---|---|
| PubChem CID | 156845932 |
| Molecular Formula | C25H30BrClN4O4Si |
| Molecular Weight | 593.98 g/mol |
| Exact Mass | 592.09 |
| IUPAC Name | tert-butyl N-[4-[3-bromo-5-cyano-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-chlorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Oc2c(C#N)cnc3c2c(Br)cn3COCC[Si](C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C25H30BrClN4O4Si/c1-25(2,3)35-24(32)30-17-7-8-20(19(27)11-17)34-22-16(12-28)13-29-23-21(22)18(26)14-31(23)15-33-9-10-36(4,5)6/h7-8,11,13-14H,9-10,15H2,1-6H3,(H,30,32) |
| InChIKey | ZMKBGVZZJAGGMH-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.98 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|