C29H44N4O5Si — CID 177243048
tert-butyl (2R,3R)-3-[5-cyano-3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2-methylpyrrolidine-1-carboxylate (PubChem CID 177243048) has the molecular formula C29H44N4O5Si and a molecular weight of 556.78 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-[5-cyano-3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-[5-cyano-3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177243048 |
| Molecular Formula | C29H44N4O5Si |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | tert-butyl (2R,3R)-3-[5-cyano-3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1[C@H](Oc2c(C#N)cnc3c2c(C2CCOCC2)cn3COCC[Si](C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H44N4O5Si/c1-20-24(8-11-33(20)28(34)38-29(2,3)4)37-26-22(16-30)17-31-27-25(26)23(21-9-12-35-13-10-21)18-32(27)19-36-14-15-39(5,6)7/h17-18,20-21,24H,8-15,19H2,1-7H3/t20-,24-/m1/s1 |
| InChIKey | PAHSGNABJHFKRR-HYBUGGRVSA-N |
| XLogP | 5.89 |
| TPSA | 98.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|