C29H48N4O4Si — CID 177243076
tert-butyl (3S,5R)-3-methyl-5-[[3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 177243076) has the molecular formula C29H48N4O4Si and a molecular weight of 544.81 g/mol. Its IUPAC name is tert-butyl (3S,5R)-3-methyl-5-[[3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-3-methyl-5-[[3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177243076 |
| Molecular Formula | C29H48N4O4Si |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | tert-butyl (3S,5R)-3-methyl-5-[[3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](Nc2ccnc3c2c(C2CCOCC2)cn3COCC[Si](C)(C)C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C29H48N4O4Si/c1-21-16-23(18-32(17-21)28(34)37-29(2,3)4)31-25-8-11-30-27-26(25)24(22-9-12-35-13-10-22)19-33(27)20-36-14-15-38(5,6)7/h8,11,19,21-23H,9-10,12-18,20H2,1-7H3,(H,30,31)/t21-,23+/m0/s1 |
| InChIKey | JLLMZRBSTLSCNB-JTHBVZDNSA-N |
| XLogP | 6.30 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|