C27H42N4O3Si — CID 177243222
1-[(4R)-3,3-dimethyl-4-[[3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 177243222) has the molecular formula C27H42N4O3Si and a molecular weight of 498.74 g/mol. Its IUPAC name is 1-[(4R)-3,3-dimethyl-4-[[3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(4R)-3,3-dimethyl-4-[[3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 177243222 |
| Molecular Formula | C27H42N4O3Si |
| Molecular Weight | 498.74 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 1-[(4R)-3,3-dimethyl-4-[[3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](Nc2ccnc3c2c(C2CCOCC2)cn3COCC[Si](C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C27H42N4O3Si/c1-7-24(32)30-17-23(27(2,3)18-30)29-22-8-11-28-26-25(22)21(20-9-12-33-13-10-20)16-31(26)19-34-14-15-35(4,5)6/h7-8,11,16,20,23H,1,9-10,12-15,17-19H2,2-6H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | QQQAKIOYWDODEC-QHCPKHFHSA-N |
| XLogP | 5.08 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|