C27H36FN3O4Si — CID 175798043
butyl N-[4-[3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2-fluorophenyl]carbamate (PubChem CID 175798043) has the molecular formula C27H36FN3O4Si and a molecular weight of 513.69 g/mol. Its IUPAC name is butyl N-[4-[3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2-fluorophenyl]carbamate.
| Compound Name | butyl N-[4-[3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 175798043 |
| Molecular Formula | C27H36FN3O4Si |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | butyl N-[4-[3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-2-fluorophenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(Oc2ccnc3c2c(C2CC2)cn3COCC[Si](C)(C)C)cc1F |
| InChI | InChI=1S/C27H36FN3O4Si/c1-5-6-13-34-27(32)30-23-10-9-20(16-22(23)28)35-24-11-12-29-26-25(24)21(19-7-8-19)17-31(26)18-33-14-15-36(2,3)4/h9-12,16-17,19H,5-8,13-15,18H2,1-4H3,(H,30,32) |
| InChIKey | AVXRGJXWMHYRGU-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|