C21H33N3O3Si — CID 152533189
tert-butyl N-[4-[5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]carbamate (PubChem CID 152533189) has the molecular formula C21H33N3O3Si and a molecular weight of 403.60 g/mol. Its IUPAC name is tert-butyl N-[4-[5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 152533189 |
| Molecular Formula | C21H33N3O3Si |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | tert-butyl N-[4-[5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]carbamate |
| SMILES | Cc1c(-c2ccc(NC(=O)OC(C)(C)C)cc2)ncn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C21H33N3O3Si/c1-16-19(22-14-24(16)15-26-12-13-28(5,6)7)17-8-10-18(11-9-17)23-20(25)27-21(2,3)4/h8-11,14H,12-13,15H2,1-7H3,(H,23,25) |
| InChIKey | YJYKWXSOEPFCNV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|