C23H35N3O3Si — CID 151832153
tert-butyl N-[4-[5-ethenyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]carbamate (PubChem CID 151832153) has the molecular formula C23H35N3O3Si and a molecular weight of 429.64 g/mol. Its IUPAC name is tert-butyl N-[4-[5-ethenyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-ethenyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 151832153 |
| Molecular Formula | C23H35N3O3Si |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | tert-butyl N-[4-[5-ethenyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]carbamate |
| SMILES | C=Cc1c(-c2ccc(NC(=O)OC(C)(C)C)cc2)c(C)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C23H35N3O3Si/c1-9-20-21(17(2)25-26(20)16-28-14-15-30(6,7)8)18-10-12-19(13-11-18)24-22(27)29-23(3,4)5/h9-13H,1,14-16H2,2-8H3,(H,24,27) |
| InChIKey | SEWQGBHPSNDXJS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|