C18H23ClN4O3SSi — CID 142530227
ethyl 3-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,2,4-thiadiazole-5-carboxylate (PubChem CID 142530227) has the molecular formula C18H23ClN4O3SSi and a molecular weight of 439.01 g/mol. Its IUPAC name is ethyl 3-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,2,4-thiadiazole-5-carboxylate.
| Compound Name | ethyl 3-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,2,4-thiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 142530227 |
| Molecular Formula | C18H23ClN4O3SSi |
| Molecular Weight | 439.01 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | ethyl 3-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-1,2,4-thiadiazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cn(COCC[Si](C)(C)C)c3nccc(Cl)c23)ns1 |
| InChI | InChI=1S/C18H23ClN4O3SSi/c1-5-26-18(24)17-21-15(22-27-17)12-10-23(11-25-8-9-28(2,3)4)16-14(12)13(19)6-7-20-16/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | PJJLFVRQSKPQJD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.01 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|