C15H18N2O2S — CID 16756770
ethyl 3-(4-tert-butylphenyl)-1,2,4-thiadiazole-5-carboxylate (PubChem CID 16756770) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is ethyl 3-(4-tert-butylphenyl)-1,2,4-thiadiazole-5-carboxylate.
| Compound Name | ethyl 3-(4-tert-butylphenyl)-1,2,4-thiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 16756770 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | ethyl 3-(4-tert-butylphenyl)-1,2,4-thiadiazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(C(C)(C)C)cc2)ns1 |
| InChI | InChI=1S/C15H18N2O2S/c1-5-19-14(18)13-16-12(17-20-13)10-6-8-11(9-7-10)15(2,3)4/h6-9H,5H2,1-4H3 |
| InChIKey | CWEMJXWDIWZCJB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |