C19H19I2NO2S — CID 68908870
ethyl 3-(4-tert-butylphenyl)-2,6-diiodo-4H-thieno[3,2-b]pyrrole-5-carboxylate (PubChem CID 68908870) has the molecular formula C19H19I2NO2S and a molecular weight of 579.24 g/mol. Its IUPAC name is ethyl 3-(4-tert-butylphenyl)-2,6-diiodo-4H-thieno[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 3-(4-tert-butylphenyl)-2,6-diiodo-4H-thieno[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 68908870 |
| Molecular Formula | C19H19I2NO2S |
| Molecular Weight | 579.24 g/mol |
| Exact Mass | 578.92 |
| IUPAC Name | ethyl 3-(4-tert-butylphenyl)-2,6-diiodo-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3ccc(C(C)(C)C)cc3)c(I)sc2c1I |
| InChI | InChI=1S/C19H19I2NO2S/c1-5-24-18(23)15-13(20)16-14(22-15)12(17(21)25-16)10-6-8-11(9-7-10)19(2,3)4/h6-9,22H,5H2,1-4H3 |
| InChIKey | RVYVULBKEWYJGW-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.24 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|