C39H34O2S — CID 11124615
ethyl 4,5,6,7-tetrakis(4-methylphenyl)-1-benzothiophene-2-carboxylate (PubChem CID 11124615) has the molecular formula C39H34O2S and a molecular weight of 566.77 g/mol. Its IUPAC name is ethyl 4,5,6,7-tetrakis(4-methylphenyl)-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 4,5,6,7-tetrakis(4-methylphenyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 11124615 |
| Molecular Formula | C39H34O2S |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | ethyl 4,5,6,7-tetrakis(4-methylphenyl)-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(-c3ccc(C)cc3)c(-c3ccc(C)cc3)c(-c3ccc(C)cc3)c(-c3ccc(C)cc3)c2s1 |
| InChI | InChI=1S/C39H34O2S/c1-6-41-39(40)33-23-32-34(28-15-7-24(2)8-16-28)35(29-17-9-25(3)10-18-29)36(30-19-11-26(4)12-20-30)37(38(32)42-33)31-21-13-27(5)14-22-31/h7-23H,6H2,1-5H3 |
| InChIKey | AKXKWCYNFSJVPN-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |