C10H9NO3S2 — CID 133062404
ethyl 3-carbamoylthieno[2,3-b]thiophene-5-carboxylate (PubChem CID 133062404) has the molecular formula C10H9NO3S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is ethyl 3-carbamoylthieno[2,3-b]thiophene-5-carboxylate.
| Compound Name | ethyl 3-carbamoylthieno[2,3-b]thiophene-5-carboxylate |
|---|---|
| PubChem CID | 133062404 |
| Molecular Formula | C10H9NO3S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | ethyl 3-carbamoylthieno[2,3-b]thiophene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(C(N)=O)csc2s1 |
| InChI | InChI=1S/C10H9NO3S2/c1-2-14-9(13)7-3-5-6(8(11)12)4-15-10(5)16-7/h3-4H,2H2,1H3,(H2,11,12) |
| InChIKey | AYTFBMUAGQVYGC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |