C9H7BrO2S2 — CID 133055284
ethyl 5-bromothieno[2,3-b]thiophene-2-carboxylate (PubChem CID 133055284) has the molecular formula C9H7BrO2S2 and a molecular weight of 291.19 g/mol. Its IUPAC name is ethyl 5-bromothieno[2,3-b]thiophene-2-carboxylate.
| Compound Name | ethyl 5-bromothieno[2,3-b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 133055284 |
| Molecular Formula | C9H7BrO2S2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 289.91 |
| IUPAC Name | ethyl 5-bromothieno[2,3-b]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(Br)sc2s1 |
| InChI | InChI=1S/C9H7BrO2S2/c1-2-12-8(11)6-3-5-4-7(10)14-9(5)13-6/h3-4H,2H2,1H3 |
| InChIKey | WPPATKQEMSAUSI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |