C14H16O2S — CID 158313823
ethyl 5,6,7-trimethyl-1-benzothiophene-2-carboxylate (PubChem CID 158313823) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is ethyl 5,6,7-trimethyl-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5,6,7-trimethyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 158313823 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | ethyl 5,6,7-trimethyl-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C)c(C)c(C)c2s1 |
| InChI | InChI=1S/C14H16O2S/c1-5-16-14(15)12-7-11-6-8(2)9(3)10(4)13(11)17-12/h6-7H,5H2,1-4H3 |
| InChIKey | DFSMNJWJGYAXAB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |