C8H5BrOS2 — CID 133059394
1-(5-bromothieno[2,3-b]thiophen-2-yl)ethanone (PubChem CID 133059394) has the molecular formula C8H5BrOS2 and a molecular weight of 261.17 g/mol. Its IUPAC name is 1-(5-bromothieno[2,3-b]thiophen-2-yl)ethanone.
| Compound Name | 1-(5-bromothieno[2,3-b]thiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 133059394 |
| Molecular Formula | C8H5BrOS2 |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 259.90 |
| IUPAC Name | 1-(5-bromothieno[2,3-b]thiophen-2-yl)ethanone |
| SMILES | CC(=O)c1cc2cc(Br)sc2s1 |
| InChI | InChI=1S/C8H5BrOS2/c1-4(10)6-2-5-3-7(9)12-8(5)11-6/h2-3H,1H3 |
| InChIKey | QBQHRKDARYXSGT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |