C8H7NO4S3 — CID 14700202
methyl 5-sulfamoylthieno[2,3-b]thiophene-2-carboxylate (PubChem CID 14700202) has the molecular formula C8H7NO4S3 and a molecular weight of 277.35 g/mol. Its IUPAC name is methyl 5-sulfamoylthieno[2,3-b]thiophene-2-carboxylate.
| Compound Name | methyl 5-sulfamoylthieno[2,3-b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 14700202 |
| Molecular Formula | C8H7NO4S3 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | methyl 5-sulfamoylthieno[2,3-b]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(S(N)(=O)=O)sc2s1 |
| InChI | InChI=1S/C8H7NO4S3/c1-13-7(10)5-2-4-3-6(16(9,11)12)15-8(4)14-5/h2-3H,1H3,(H2,9,11,12) |
| InChIKey | HXNLNHYNSQAKRY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |