C12H13NO3S2 — CID 133062598
tert-butyl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate (PubChem CID 133062598) has the molecular formula C12H13NO3S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate.
| Compound Name | tert-butyl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate |
|---|---|
| PubChem CID | 133062598 |
| Molecular Formula | C12H13NO3S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | tert-butyl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc2cc(C(N)=O)sc2s1 |
| InChI | InChI=1S/C12H13NO3S2/c1-12(2,3)16-10(15)8-5-6-4-7(9(13)14)17-11(6)18-8/h4-5H,1-3H3,(H2,13,14) |
| InChIKey | QSSBQGFPSLHMHK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |