C10H13N3O3S — CID 143086314
tert-butyl 3-amino-1-hydroxythieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 143086314) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is tert-butyl 3-amino-1-hydroxythieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | tert-butyl 3-amino-1-hydroxythieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 143086314 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | tert-butyl 3-amino-1-hydroxythieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc2c(N)nn(O)c2s1 |
| InChI | InChI=1S/C10H13N3O3S/c1-10(2,3)16-9(14)6-4-5-7(11)12-13(15)8(5)17-6/h4,15H,1-3H3,(H2,11,12) |
| InChIKey | OXYNJTWFYIEJPF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|