C9H13NO4S2 — CID 116688224
tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate (PubChem CID 116688224) has the molecular formula C9H13NO4S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate.
| Compound Name | tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 116688224 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(S(C)(=O)=O)ns1 |
| InChI | InChI=1S/C9H13NO4S2/c1-9(2,3)14-8(11)6-5-7(10-15-6)16(4,12)13/h5H,1-4H3 |
| InChIKey | JJNBPBAXVWLOPR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |