About tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate
tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate (PubChem CID 116688224) has the molecular formula C9H13NO4S2
and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate |
| PubChem CID | 116688224 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(S(C)(=O)=O)ns1 |
| InChI | InChI=1S/C9H13NO4S2/c1-9(2,3)14-8(11)6-5-7(10-15-6)16(4,12)13/h5H,1-4H3 |
| InChIKey | JJNBPBAXVWLOPR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate?
The IUPAC name of tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate (CID 116688224) is tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate.
What is the SMILES notation for tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate?
The canonical SMILES for tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate is CC(C)(C)OC(=O)c1cc(S(C)(=O)=O)ns1.
What is the InChIKey of tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate?
The InChIKey is JJNBPBAXVWLOPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4S2/c1-9(2,3)14-8(11)6-5-7(10-15-6)16(4,12)13/h5H,1-4H3.
What are the key properties of tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate?
tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate has a molecular weight of 263.34 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-methylsulfonyl-1,2-thiazole-5-carboxylate is sourced from PubChem (CID 116688224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).