About lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate
lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate (PubChem CID 164805918) has the molecular formula C9H11LiO2S
and a molecular weight of 190.19 g/mol. Its IUPAC name is lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate.
Molecular Properties
| Compound Name | lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate |
| PubChem CID | 164805918 |
| Molecular Formula | C9H11LiO2S |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc[c-]s1.[Li+] |
| InChI | InChI=1S/C9H11O2S.Li/c1-9(2,3)11-8(10)7-5-4-6-12-7;/h4-5H,1-3H3;/q-1;+1 |
| InChIKey | RBMDAIWBSFJLHI-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate?
The IUPAC name of lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate (CID 164805918) is lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate.
What is the SMILES notation for lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate?
The canonical SMILES for lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate is CC(C)(C)OC(=O)c1cc[c-]s1.[Li+].
What is the InChIKey of lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate?
The InChIKey is RBMDAIWBSFJLHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O2S.Li/c1-9(2,3)11-8(10)7-5-4-6-12-7;/h4-5H,1-3H3;/q-1;+1.
What are the key properties of lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate?
lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate has a molecular weight of 190.19 g/mol, XLogP of -0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium tert-butyl 2H-thiophen-2-ide-5-carboxylate is sourced from PubChem (CID 164805918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).