C11H12O3S2 — CID 133061132
tert-butyl 3-hydroxythieno[2,3-b]thiophene-5-carboxylate (PubChem CID 133061132) has the molecular formula C11H12O3S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl 3-hydroxythieno[2,3-b]thiophene-5-carboxylate.
| Compound Name | tert-butyl 3-hydroxythieno[2,3-b]thiophene-5-carboxylate |
|---|---|
| PubChem CID | 133061132 |
| Molecular Formula | C11H12O3S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | tert-butyl 3-hydroxythieno[2,3-b]thiophene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc2c(O)csc2s1 |
| InChI | InChI=1S/C11H12O3S2/c1-11(2,3)14-9(13)8-4-6-7(12)5-15-10(6)16-8/h4-5,12H,1-3H3 |
| InChIKey | VXJNUMALWKSUOR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|