C12H12BrNO2S — CID 166604363
tert-butyl 4-bromothieno[2,3-c]pyridine-2-carboxylate (PubChem CID 166604363) has the molecular formula C12H12BrNO2S and a molecular weight of 314.20 g/mol. Its IUPAC name is tert-butyl 4-bromothieno[2,3-c]pyridine-2-carboxylate.
| Compound Name | tert-butyl 4-bromothieno[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 166604363 |
| Molecular Formula | C12H12BrNO2S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | tert-butyl 4-bromothieno[2,3-c]pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc2c(Br)cncc2s1 |
| InChI | InChI=1S/C12H12BrNO2S/c1-12(2,3)16-11(15)9-4-7-8(13)5-14-6-10(7)17-9/h4-6H,1-3H3 |
| InChIKey | SKMKDBZQQOLSIG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |