About methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate
methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate (PubChem CID 162639500) has the molecular formula C17H13BrN2O3S
and a molecular weight of 405.27 g/mol. Its IUPAC name is methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate |
| PubChem CID | 162639500 |
| Molecular Formula | C17H13BrN2O3S |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CNC(=O)c2cc3c(Br)cncc3s2)c1 |
| InChI | InChI=1S/C17H13BrN2O3S/c1-23-17(22)11-4-2-3-10(5-11)7-20-16(21)14-6-12-13(18)8-19-9-15(12)24-14/h2-6,8-9H,7H2,1H3,(H,20,21) |
| InChIKey | MHJVDLVYGJOUPJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate?
The IUPAC name of methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate (CID 162639500) is methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate.
What is the SMILES notation for methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate?
The canonical SMILES for methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate is COC(=O)c1cccc(CNC(=O)c2cc3c(Br)cncc3s2)c1.
What is the InChIKey of methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate?
The InChIKey is MHJVDLVYGJOUPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrN2O3S/c1-23-17(22)11-4-2-3-10(5-11)7-20-16(21)14-6-12-13(18)8-19-9-15(12)24-14/h2-6,8-9H,7H2,1H3,(H,20,21).
What are the key properties of methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate?
methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate has a molecular weight of 405.27 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[(4-bromothieno[2,3-c]pyridine-2-carbonyl)amino]methyl]benzoate is sourced from PubChem (CID 162639500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).