C13H14FN3O3S — CID 169101294
tert-butyl N-[(4-fluorothieno[2,3-c]pyridine-2-carbonyl)amino]carbamate (PubChem CID 169101294) has the molecular formula C13H14FN3O3S and a molecular weight of 311.34 g/mol. Its IUPAC name is tert-butyl N-[(4-fluorothieno[2,3-c]pyridine-2-carbonyl)amino]carbamate.
| Compound Name | tert-butyl N-[(4-fluorothieno[2,3-c]pyridine-2-carbonyl)amino]carbamate |
|---|---|
| PubChem CID | 169101294 |
| Molecular Formula | C13H14FN3O3S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | tert-butyl N-[(4-fluorothieno[2,3-c]pyridine-2-carbonyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)c1cc2c(F)cncc2s1 |
| InChI | InChI=1S/C13H14FN3O3S/c1-13(2,3)20-12(19)17-16-11(18)9-4-7-8(14)5-15-6-10(7)21-9/h4-6H,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | UXCGDTUIMPMASD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|