C11H14ClN3O3 — CID 16654125
tert-butyl N-[(6-chloropyridine-3-carbonyl)amino]carbamate (PubChem CID 16654125) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is tert-butyl N-[(6-chloropyridine-3-carbonyl)amino]carbamate.
| Compound Name | tert-butyl N-[(6-chloropyridine-3-carbonyl)amino]carbamate |
|---|---|
| PubChem CID | 16654125 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | tert-butyl N-[(6-chloropyridine-3-carbonyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H14ClN3O3/c1-11(2,3)18-10(17)15-14-9(16)7-4-5-8(12)13-6-7/h4-6H,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | MSSLTJRDRVQRQW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|